C9H6F3NOS — CID 9267878
(1S)-1-(1,3-benzothiazol-2-yl)-2,2,2-trifluoroethanol (PubChem CID 9267878) has the molecular formula C9H6F3NOS and a molecular weight of 233.21 g/mol. Its IUPAC name is (1S)-1-(1,3-benzothiazol-2-yl)-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-(1,3-benzothiazol-2-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 9267878 |
| Molecular Formula | C9H6F3NOS |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | (1S)-1-(1,3-benzothiazol-2-yl)-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1nc2ccccc2s1)C(F)(F)F |
| InChI | InChI=1S/C9H6F3NOS/c10-9(11,12)7(14)8-13-5-3-1-2-4-6(5)15-8/h1-4,7,14H/t7-/m1/s1 |
| InChIKey | VIIWUYMGSVRMGH-SSDOTTSWSA-N |
| XLogP | 2.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |