C10H9F3N2S — CID 82384630
1-(1,3-benzothiazol-2-yl)-3,3,3-trifluoropropan-1-amine (PubChem CID 82384630) has the molecular formula C10H9F3N2S and a molecular weight of 246.26 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 82384630 |
| Molecular Formula | C10H9F3N2S |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NC(CC(F)(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H9F3N2S/c11-10(12,13)5-6(14)9-15-7-3-1-2-4-8(7)16-9/h1-4,6H,5,14H2 |
| InChIKey | ZXNPXKZVHAUKMC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |