C16H14F2N2S — CID 115524719
1-(1,3-benzothiazol-2-yl)-2-[4-(difluoromethyl)phenyl]ethanamine (PubChem CID 115524719) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-[4-(difluoromethyl)phenyl]ethanamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-[4-(difluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 115524719 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-[4-(difluoromethyl)phenyl]ethanamine |
| SMILES | NC(Cc1ccc(C(F)F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14F2N2S/c17-15(18)11-7-5-10(6-8-11)9-12(19)16-20-13-3-1-2-4-14(13)21-16/h1-8,12,15H,9,19H2 |
| InChIKey | FGMHOHNKIIFWJD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |