C22H19NOS2 — CID 4267801
2-(1,3-benzothiazol-2-ylsulfanyl)-1,1-diphenylpropan-1-ol (PubChem CID 4267801) has the molecular formula C22H19NOS2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-1,1-diphenylpropan-1-ol.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1,1-diphenylpropan-1-ol |
|---|---|
| PubChem CID | 4267801 |
| Molecular Formula | C22H19NOS2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1,1-diphenylpropan-1-ol |
| SMILES | CC(Sc1nc2ccccc2s1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NOS2/c1-16(25-21-23-19-14-8-9-15-20(19)26-21)22(24,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-16,24H,1H3 |
| InChIKey | QFOOCADYQLKEBE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |