C11H9NS2 — CID 94044815
2-[(2S)-but-3-yn-2-yl]sulfanyl-1,3-benzothiazole (PubChem CID 94044815) has the molecular formula C11H9NS2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2S)-but-3-yn-2-yl]sulfanyl-1,3-benzothiazole.
| Compound Name | 2-[(2S)-but-3-yn-2-yl]sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 94044815 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-[(2S)-but-3-yn-2-yl]sulfanyl-1,3-benzothiazole |
| SMILES | C#C[C@H](C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H9NS2/c1-3-8(2)13-11-12-9-6-4-5-7-10(9)14-11/h1,4-8H,2H3/t8-/m0/s1 |
| InChIKey | JTAIXYBEEBDEEH-QMMMGPOBSA-N |
| XLogP | 3.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|