C13H18N2S3 — CID 21441515
N-(1,3-benzothiazol-2-yldisulfanyl)-N-propan-2-ylpropan-2-amine (PubChem CID 21441515) has the molecular formula C13H18N2S3 and a molecular weight of 298.50 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yldisulfanyl)-N-propan-2-ylpropan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-yldisulfanyl)-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 21441515 |
| Molecular Formula | C13H18N2S3 |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yldisulfanyl)-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)N(SSc1nc2ccccc2s1)C(C)C |
| InChI | InChI=1S/C13H18N2S3/c1-9(2)15(10(3)4)18-17-13-14-11-7-5-6-8-12(11)16-13/h5-10H,1-4H3 |
| InChIKey | ZSUNYYBBKQLQPK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|