C24H14N2S6 — CID 18349403
2-[[4-(1,3-benzothiazol-2-yldisulfanyl)naphthalen-1-yl]disulfanyl]-1,3-benzothiazole (PubChem CID 18349403) has the molecular formula C24H14N2S6 and a molecular weight of 522.79 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yldisulfanyl)naphthalen-1-yl]disulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yldisulfanyl)naphthalen-1-yl]disulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 18349403 |
| Molecular Formula | C24H14N2S6 |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 521.95 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yldisulfanyl)naphthalen-1-yl]disulfanyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(SSc3ccc(SSc4nc5ccccc5s4)c4ccccc34)nc2c1 |
| InChI | InChI=1S/C24H14N2S6/c1-2-8-16-15(7-1)19(29-31-23-25-17-9-3-5-11-21(17)27-23)13-14-20(16)30-32-24-26-18-10-4-6-12-22(18)28-24/h1-14H |
| InChIKey | YOMQTLPROMDAKF-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|