C17H11NO2S2 — CID 15141994
2-(1,3-benzothiazol-2-ylsulfanyl)naphthalene-1,4-diol (PubChem CID 15141994) has the molecular formula C17H11NO2S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)naphthalene-1,4-diol.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)naphthalene-1,4-diol |
|---|---|
| PubChem CID | 15141994 |
| Molecular Formula | C17H11NO2S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)naphthalene-1,4-diol |
| SMILES | Oc1cc(Sc2nc3ccccc3s2)c(O)c2ccccc12 |
| InChI | InChI=1S/C17H11NO2S2/c19-13-9-15(16(20)11-6-2-1-5-10(11)13)22-17-18-12-7-3-4-8-14(12)21-17/h1-9,19-20H |
| InChIKey | NDXJHEIPMGZNNK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|