C31H29N3O3S3 — CID 156749760
(3E)-N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-4-[benzyl(methyl)amino]-2-methylpenta-1,3-diene-3-sulfonamide (PubChem CID 156749760) has the molecular formula C31H29N3O3S3 and a molecular weight of 587.79 g/mol. Its IUPAC name is (3E)-N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-4-[benzyl(methyl)amino]-2-methylpenta-1,3-diene-3-sulfonamide.
| Compound Name | (3E)-N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-4-[benzyl(methyl)amino]-2-methylpenta-1,3-diene-3-sulfonamide |
|---|---|
| PubChem CID | 156749760 |
| Molecular Formula | C31H29N3O3S3 |
| Molecular Weight | 587.79 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | (3E)-N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-4-[benzyl(methyl)amino]-2-methylpenta-1,3-diene-3-sulfonamide |
| SMILES | C=C(C)/C(=C(/C)N(C)Cc1ccccc1)S(=O)(=O)Nc1cc(Sc2nc3ccccc3s2)c(O)c2ccccc12 |
| InChI | InChI=1S/C31H29N3O3S3/c1-20(2)30(21(3)34(4)19-22-12-6-5-7-13-22)40(36,37)33-26-18-28(29(35)24-15-9-8-14-23(24)26)39-31-32-25-16-10-11-17-27(25)38-31/h5-18,33,35H,1,19H2,2-4H3/b30-21+ |
| InChIKey | RTXRPTFECHMIIW-MWAVMZGNSA-N |
| XLogP | 7.99 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|