C23H22N2O3S3 — CID 4856227
N-[5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-2-methylphenyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 4856227) has the molecular formula C23H22N2O3S3 and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-2-methylphenyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-2-methylphenyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4856227 |
| Molecular Formula | C23H22N2O3S3 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxy-2-methylphenyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2cc(Sc3nc4ccccc4s3)c(O)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H22N2O3S3/c1-13-9-15(3)22(16(4)10-13)31(27,28)25-18-12-21(19(26)11-14(18)2)30-23-24-17-7-5-6-8-20(17)29-23/h5-12,25-26H,1-4H3 |
| InChIKey | KMVAOCIXKBUYAU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|