C19H14N2O3S3 — CID 6620635
N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxyphenyl]benzenesulfonamide (PubChem CID 6620635) has the molecular formula C19H14N2O3S3 and a molecular weight of 414.53 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxyphenyl]benzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6620635 |
| Molecular Formula | C19H14N2O3S3 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxyphenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)c(Sc2nc3ccccc3s2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H14N2O3S3/c22-16-11-10-13(21-27(23,24)14-6-2-1-3-7-14)12-18(16)26-19-20-15-8-4-5-9-17(15)25-19/h1-12,21-22H |
| InChIKey | QNCXLJHWIBYWBM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|