C14H11N3O5S3 — CID 29457221
4-hydroxy-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide (PubChem CID 29457221) has the molecular formula C14H11N3O5S3 and a molecular weight of 397.46 g/mol. Its IUPAC name is 4-hydroxy-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 29457221 |
| Molecular Formula | C14H11N3O5S3 |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 4-hydroxy-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide |
| SMILES | CSc1nc2ccc(NS(=O)(=O)c3ccc(O)c([N+](=O)[O-])c3)cc2s1 |
| InChI | InChI=1S/C14H11N3O5S3/c1-23-14-15-10-4-2-8(6-13(10)24-14)16-25(21,22)9-3-5-12(18)11(7-9)17(19)20/h2-7,16,18H,1H3 |
| InChIKey | MKCZWDHMXKXYOY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|