C17H16N4O6S2 — CID 39770439
4-hydroxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide (PubChem CID 39770439) has the molecular formula C17H16N4O6S2 and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-hydroxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 39770439 |
| Molecular Formula | C17H16N4O6S2 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 4-hydroxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccc3nc(N4CCOCC4)sc3c2)ccc1O |
| InChI | InChI=1S/C17H16N4O6S2/c22-15-4-2-12(10-14(15)21(23)24)29(25,26)19-11-1-3-13-16(9-11)28-17(18-13)20-5-7-27-8-6-20/h1-4,9-10,19,22H,5-8H2 |
| InChIKey | HOUOKDQFOZFDTC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|