C19H26N4O2S — CID 75466716
1-cycloheptyl-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)urea (PubChem CID 75466716) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-cycloheptyl-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 75466716 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-cycloheptyl-3-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)urea |
| SMILES | O=C(Nc1ccc2nc(N3CCOCC3)sc2c1)NC1CCCCCC1 |
| InChI | InChI=1S/C19H26N4O2S/c24-18(20-14-5-3-1-2-4-6-14)21-15-7-8-16-17(13-15)26-19(22-16)23-9-11-25-12-10-23/h7-8,13-14H,1-6,9-12H2,(H2,20,21,24) |
| InChIKey | LFDMRGGZPDUFBH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |