C16H15N3O3S — CID 27021882
N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)furan-3-carboxamide (PubChem CID 27021882) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)furan-3-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)furan-3-carboxamide |
|---|---|
| PubChem CID | 27021882 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)furan-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc(N3CCOCC3)sc2c1)c1ccoc1 |
| InChI | InChI=1S/C16H15N3O3S/c20-15(11-3-6-22-10-11)17-12-1-2-13-14(9-12)23-16(18-13)19-4-7-21-8-5-19/h1-3,6,9-10H,4-5,7-8H2,(H,17,20) |
| InChIKey | LPVDFLCKSIPWAE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |