C21H23N3O5S — CID 17493258
2,4,5-trimethoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 17493258) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 2,4,5-trimethoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 17493258 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2,4,5-trimethoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc3nc(N4CCOCC4)sc3c2)cc1OC |
| InChI | InChI=1S/C21H23N3O5S/c1-26-16-12-18(28-3)17(27-2)11-14(16)20(25)22-13-4-5-15-19(10-13)30-21(23-15)24-6-8-29-9-7-24/h4-5,10-12H,6-9H2,1-3H3,(H,22,25) |
| InChIKey | CMZASXORTYREFT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |