C16H22N4O3S — CID 120594765
4-amino-3-methoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)butanamide (PubChem CID 120594765) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)butanamide |
|---|---|
| PubChem CID | 120594765 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-amino-3-methoxy-N-(2-morpholin-4-yl-1,3-benzothiazol-6-yl)butanamide |
| SMILES | COC(CN)CC(=O)Nc1ccc2nc(N3CCOCC3)sc2c1 |
| InChI | InChI=1S/C16H22N4O3S/c1-22-12(10-17)9-15(21)18-11-2-3-13-14(8-11)24-16(19-13)20-4-6-23-7-5-20/h2-3,8,12H,4-7,9-10,17H2,1H3,(H,18,21) |
| InChIKey | VOBVFNUPHWRMSM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |