C15H14N4O3S — CID 126140188
1-cyclopropyl-3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]urea (PubChem CID 126140188) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]urea |
|---|---|
| PubChem CID | 126140188 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]urea |
| SMILES | O=C(Nc1ccc2nc(N3C(=O)CCC3=O)sc2c1)NC1CC1 |
| InChI | InChI=1S/C15H14N4O3S/c20-12-5-6-13(21)19(12)15-18-10-4-3-9(7-11(10)23-15)17-14(22)16-8-1-2-8/h3-4,7-8H,1-2,5-6H2,(H2,16,17,22) |
| InChIKey | QWVYHHAAZZLVKO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|