C22H27N5O4S — CID 126136195
(3S)-1-N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-N,3-N-diethylpiperidine-1,3-dicarboxamide (PubChem CID 126136195) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is (3S)-1-N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-N,3-N-diethylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-1-N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 126136195 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | (3S)-1-N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1CCCN(C(=O)Nc2ccc3nc(N4C(=O)CCC4=O)sc3c2)C1 |
| InChI | InChI=1S/C22H27N5O4S/c1-3-25(4-2)20(30)14-6-5-11-26(13-14)21(31)23-15-7-8-16-17(12-15)32-22(24-16)27-18(28)9-10-19(27)29/h7-8,12,14H,3-6,9-11,13H2,1-2H3,(H,23,31)/t14-/m0/s1 |
| InChIKey | STSZFOWJBPZJSB-AWEZNQCLSA-N |
| XLogP | 3.06 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|