C17H24ClN3O2 — CID 3697126
1-N-(4-chlorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide (PubChem CID 3697126) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3697126 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-N-(4-chlorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C17H24ClN3O2/c1-3-20(4-2)16(22)13-6-5-11-21(12-13)17(23)19-15-9-7-14(18)8-10-15/h7-10,13H,3-6,11-12H2,1-2H3,(H,19,23) |
| InChIKey | VEDLFBKTISXHGU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |