C17H23F2N3O2 — CID 42695569
1-N-(2,4-difluorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide (PubChem CID 42695569) has the molecular formula C17H23F2N3O2 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-N-(2,4-difluorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-(2,4-difluorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42695569 |
| Molecular Formula | C17H23F2N3O2 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-N-(2,4-difluorophenyl)-3-N,3-N-diethylpiperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1CCCN(C(=O)Nc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H23F2N3O2/c1-3-21(4-2)16(23)12-6-5-9-22(11-12)17(24)20-15-8-7-13(18)10-14(15)19/h7-8,10,12H,3-6,9,11H2,1-2H3,(H,20,24) |
| InChIKey | QEEMGENSNXDZJL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |