C18H22N4O3S — CID 126148165
3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1,1-di(propan-2-yl)urea (PubChem CID 126148165) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1,1-di(propan-2-yl)urea.
| Compound Name | 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1,1-di(propan-2-yl)urea |
|---|---|
| PubChem CID | 126148165 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1,1-di(propan-2-yl)urea |
| SMILES | CC(C)N(C(=O)Nc1ccc2nc(N3C(=O)CCC3=O)sc2c1)C(C)C |
| InChI | InChI=1S/C18H22N4O3S/c1-10(2)21(11(3)4)17(25)19-12-5-6-13-14(9-12)26-18(20-13)22-15(23)7-8-16(22)24/h5-6,9-11H,7-8H2,1-4H3,(H,19,25) |
| InChIKey | JKDMZRQVWHFTRY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|