C22H20N4O4S — CID 1278511
2-(2,5-dioxopyrrolidin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 1278511) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 1278511 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(4-morpholin-4-ylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1ccc2nc(N3C(=O)CCC3=O)sc2c1 |
| InChI | InChI=1S/C22H20N4O4S/c27-19-7-8-20(28)26(19)22-24-17-6-1-14(13-18(17)31-22)21(29)23-15-2-4-16(5-3-15)25-9-11-30-12-10-25/h1-6,13H,7-12H2,(H,23,29) |
| InChIKey | BKYYYYQXGOETKP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|