C18H20N4O3S — CID 126152037
N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]azepane-1-carboxamide (PubChem CID 126152037) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]azepane-1-carboxamide.
| Compound Name | N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]azepane-1-carboxamide |
|---|---|
| PubChem CID | 126152037 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]azepane-1-carboxamide |
| SMILES | O=C(Nc1ccc2nc(N3C(=O)CCC3=O)sc2c1)N1CCCCCC1 |
| InChI | InChI=1S/C18H20N4O3S/c23-15-7-8-16(24)22(15)18-20-13-6-5-12(11-14(13)26-18)19-17(25)21-9-3-1-2-4-10-21/h5-6,11H,1-4,7-10H2,(H,19,25) |
| InChIKey | RJIYFSWHGUCRQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|