C20H18N4O4S — CID 126143251
3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1-(4-methoxyphenyl)-1-methylurea (PubChem CID 126143251) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1-(4-methoxyphenyl)-1-methylurea.
| Compound Name | 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1-(4-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 126143251 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrolidin-1-yl)-1,3-benzothiazol-6-yl]-1-(4-methoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(N(C)C(=O)Nc2ccc3nc(N4C(=O)CCC4=O)sc3c2)cc1 |
| InChI | InChI=1S/C20H18N4O4S/c1-23(13-4-6-14(28-2)7-5-13)19(27)21-12-3-8-15-16(11-12)29-20(22-15)24-17(25)9-10-18(24)26/h3-8,11H,9-10H2,1-2H3,(H,21,27) |
| InChIKey | ZFXDWRPSKHLHOG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|