C23H26N4O2S — CID 91344737
N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 91344737) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 91344737 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc3nc(N4CC[C@@H](N(C)C)C4)sc3c2)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-26(2)18-12-13-27(15-18)23-25-20-10-7-17(14-21(20)30-23)24-22(28)11-6-16-4-8-19(29-3)9-5-16/h4-11,14,18H,12-13,15H2,1-3H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | XCUHAQKEOSBIAX-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|