C26H26N4OS — CID 68774569
(Z)-N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-naphthalen-2-ylprop-2-enamide (PubChem CID 68774569) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is (Z)-N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-naphthalen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 68774569 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (Z)-N-[2-[3-(dimethylamino)pyrrolidin-1-yl]-1,3-benzothiazol-6-yl]-3-naphthalen-2-ylprop-2-enamide |
| SMILES | CN(C)C1CCN(c2nc3ccc(NC(=O)/C=C\c4ccc5ccccc5c4)cc3s2)C1 |
| InChI | InChI=1S/C26H26N4OS/c1-29(2)22-13-14-30(17-22)26-28-23-11-10-21(16-24(23)32-26)27-25(31)12-8-18-7-9-19-5-3-4-6-20(19)15-18/h3-12,15-16,22H,13-14,17H2,1-2H3,(H,27,31)/b12-8- |
| InChIKey | JXFGLDAQVSAWJN-WQLSENKSSA-N |
| XLogP | 5.24 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|