C27H18N4O3S — CID 126142296
3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-1-methyl-1-naphthalen-2-ylurea (PubChem CID 126142296) has the molecular formula C27H18N4O3S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-1-methyl-1-naphthalen-2-ylurea.
| Compound Name | 3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-1-methyl-1-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 126142296 |
| Molecular Formula | C27H18N4O3S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-1-methyl-1-naphthalen-2-ylurea |
| SMILES | CN(C(=O)Nc1ccc2nc(N3C(=O)c4ccccc4C3=O)sc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H18N4O3S/c1-30(19-12-10-16-6-2-3-7-17(16)14-19)26(34)28-18-11-13-22-23(15-18)35-27(29-22)31-24(32)20-8-4-5-9-21(20)25(31)33/h2-15H,1H3,(H,28,34) |
| InChIKey | VTBVSSVKPHTSOO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|