C23H16N4O3S — CID 126138217
1-benzyl-3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]urea (PubChem CID 126138217) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-benzyl-3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]urea.
| Compound Name | 1-benzyl-3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]urea |
|---|---|
| PubChem CID | 126138217 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-benzyl-3-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccc2nc(N3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C23H16N4O3S/c28-20-16-8-4-5-9-17(16)21(29)27(20)23-26-18-11-10-15(12-19(18)31-23)25-22(30)24-13-14-6-2-1-3-7-14/h1-12H,13H2,(H2,24,25,30) |
| InChIKey | PPXKSMMMZQMMEM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|