C21H14N4O4S — CID 126142980
1-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-3-(furan-2-ylmethyl)urea (PubChem CID 126142980) has the molecular formula C21H14N4O4S and a molecular weight of 418.43 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 126142980 |
| Molecular Formula | C21H14N4O4S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]-3-(furan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccco1)Nc1ccc2nc(N3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C21H14N4O4S/c26-18-14-5-1-2-6-15(14)19(27)25(18)21-24-16-8-7-12(10-17(16)30-21)23-20(28)22-11-13-4-3-9-29-13/h1-10H,11H2,(H2,22,23,28) |
| InChIKey | YLENVOCPCMEBEJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|