C24H16N4O5S — CID 126142575
methyl 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]carbamoylamino]benzoate (PubChem CID 126142575) has the molecular formula C24H16N4O5S and a molecular weight of 472.48 g/mol. Its IUPAC name is methyl 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]carbamoylamino]benzoate.
| Compound Name | methyl 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 126142575 |
| Molecular Formula | C24H16N4O5S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | methyl 4-[[2-(1,3-dioxoisoindol-2-yl)-1,3-benzothiazol-6-yl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2ccc3nc(N4C(=O)c5ccccc5C4=O)sc3c2)cc1 |
| InChI | InChI=1S/C24H16N4O5S/c1-33-22(31)13-6-8-14(9-7-13)25-23(32)26-15-10-11-18-19(12-15)34-24(27-18)28-20(29)16-4-2-3-5-17(16)21(28)30/h2-12H,1H3,(H2,25,26,32) |
| InChIKey | YIDBUYQOSKIICD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|