C13H13N5O2 — CID 893567
1-(furan-2-ylmethyl)-3-(1-methylbenzotriazol-5-yl)urea (PubChem CID 893567) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(1-methylbenzotriazol-5-yl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(1-methylbenzotriazol-5-yl)urea |
|---|---|
| PubChem CID | 893567 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(1-methylbenzotriazol-5-yl)urea |
| SMILES | Cn1nnc2cc(NC(=O)NCc3ccco3)ccc21 |
| InChI | InChI=1S/C13H13N5O2/c1-18-12-5-4-9(7-11(12)16-17-18)15-13(19)14-8-10-3-2-6-20-10/h2-7H,8H2,1H3,(H2,14,15,19) |
| InChIKey | KCZRQAWLAXLQLE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |