C8H10N6O — CID 126153811
1-amino-3-(1-methylbenzotriazol-5-yl)urea (PubChem CID 126153811) has the molecular formula C8H10N6O and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-amino-3-(1-methylbenzotriazol-5-yl)urea.
| Compound Name | 1-amino-3-(1-methylbenzotriazol-5-yl)urea |
|---|---|
| PubChem CID | 126153811 |
| Molecular Formula | C8H10N6O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-amino-3-(1-methylbenzotriazol-5-yl)urea |
| SMILES | Cn1nnc2cc(NC(=O)NN)ccc21 |
| InChI | InChI=1S/C8H10N6O/c1-14-7-3-2-5(10-8(15)11-9)4-6(7)12-13-14/h2-4H,9H2,1H3,(H2,10,11,15) |
| InChIKey | MMGKGPPCFRDJNW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|