C10H9N7OS — CID 126147580
1-(1-methylbenzotriazol-5-yl)-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 126147580) has the molecular formula C10H9N7OS and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-(1-methylbenzotriazol-5-yl)-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(1-methylbenzotriazol-5-yl)-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 126147580 |
| Molecular Formula | C10H9N7OS |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-(1-methylbenzotriazol-5-yl)-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | Cn1nnc2cc(NC(=O)Nc3nncs3)ccc21 |
| InChI | InChI=1S/C10H9N7OS/c1-17-8-3-2-6(4-7(8)14-16-17)12-9(18)13-10-15-11-5-19-10/h2-5H,1H3,(H2,12,13,15,18) |
| InChIKey | JGRMQNYGUXEOSW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |