C18H15N5O3S — CID 5309843
1-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 5309843) has the molecular formula C18H15N5O3S and a molecular weight of 381.42 g/mol. Its IUPAC name is 1-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 5309843 |
| Molecular Formula | C18H15N5O3S |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1)Nc1nncs1 |
| InChI | InChI=1S/C18H15N5O3S/c24-15-13-9-1-2-10(7-9)14(13)16(25)23(15)12-5-3-11(4-6-12)20-17(26)21-18-22-19-8-27-18/h1-6,8-10,13-14H,7H2,(H2,20,21,22,26) |
| InChIKey | VCYGYGXZDLJGCA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|