C13H13N5O3S — CID 98143924
1-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 98143924) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 1-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 98143924 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1-[[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]methyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | O=C(NCN1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2C1)Nc1nncs1 |
| InChI | InChI=1S/C13H13N5O3S/c19-10-8-6-1-2-7(3-6)9(8)11(20)18(10)4-14-12(21)16-13-17-15-5-22-13/h1-2,5-9H,3-4H2,(H2,14,16,17,21)/t6-,7-,8-,9+/m0/s1 |
| InChIKey | IVHYUQDKEMZHSK-XSPKLOCKSA-N |
| XLogP | 0.42 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|