C18H18BrN3O3 — CID 129450179
1-(4-bromophenyl)-3-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]urea (PubChem CID 129450179) has the molecular formula C18H18BrN3O3 and a molecular weight of 404.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]urea |
|---|---|
| PubChem CID | 129450179 |
| Molecular Formula | C18H18BrN3O3 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 1-(4-bromophenyl)-3-[[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]urea |
| SMILES | O=C(NCN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O3/c19-12-5-7-13(8-6-12)21-18(25)20-9-22-16(23)14-10-1-2-11(4-3-10)15(14)17(22)24/h1-2,5-8,10-11,14-15H,3-4,9H2,(H2,20,21,25)/t10-,11-,14+,15+/m0/s1 |
| InChIKey | HUJVRXJQVARFGQ-UOVKNHIHSA-N |
| XLogP | 2.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|