C18H17BrN2O3 — CID 98304311
N-(4-bromophenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]acetamide (PubChem CID 98304311) has the molecular formula C18H17BrN2O3 and a molecular weight of 389.25 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]acetamide |
|---|---|
| PubChem CID | 98304311 |
| Molecular Formula | C18H17BrN2O3 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-(4-bromophenyl)-2-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrN2O3/c19-12-5-7-13(8-6-12)20-14(22)9-21-17(23)15-10-1-2-11(4-3-10)16(15)18(21)24/h1-2,5-8,10-11,15-16H,3-4,9H2,(H,20,22)/t10-,11-,15-,16-/m0/s1 |
| InChIKey | WDHZPCLTJVUGSB-GREKMHCPSA-N |
| XLogP | 2.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|