C19H21N3O4 — CID 98305396
1-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]-3-(2-methoxyphenyl)urea (PubChem CID 98305396) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 1-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 98305396 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]methyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)NCN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C19H21N3O4/c1-26-14-5-3-2-4-13(14)21-19(25)20-10-22-17(23)15-11-6-7-12(9-8-11)16(15)18(22)24/h2-7,11-12,15-16H,8-10H2,1H3,(H2,20,21,25)/t11-,12-,15-,16-/m0/s1 |
| InChIKey | KUGPVWXBXJAHPD-APYUEPQZSA-N |
| XLogP | 1.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|