C20H23N3O4 — CID 98305269
1-[(1S)-1-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 98305269) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[(1S)-1-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[(1S)-1-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 98305269 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(1S)-1-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)N[C@H](C)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-11(21-20(26)22-14-5-3-4-6-15(14)27-2)23-18(24)16-12-7-8-13(10-9-12)17(16)19(23)25/h3-8,11-13,16-17H,9-10H2,1-2H3,(H2,21,22,26)/t11-,12-,13-,16-,17+/m0/s1 |
| InChIKey | SCAMJAYQNAPQIY-UCQBOQSVSA-N |
| XLogP | 2.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|