C19H20BrN3O3 — CID 98305304
1-(4-bromophenyl)-3-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea (PubChem CID 98305304) has the molecular formula C19H20BrN3O3 and a molecular weight of 418.29 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 98305304 |
| Molecular Formula | C19H20BrN3O3 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(Br)cc1)N1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C19H20BrN3O3/c1-10(21-19(26)22-14-8-6-13(20)7-9-14)23-17(24)15-11-2-3-12(5-4-11)16(15)18(23)25/h2-3,6-12,15-16H,4-5H2,1H3,(H2,21,22,26)/t10-,11+,12+,15+,16+/m1/s1 |
| InChIKey | DALKBSCCOXUBSE-BFPXCNAZSA-N |
| XLogP | 3.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|