C26H27N3O3 — CID 53277091
1-[1-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-phenylethyl]-3-(4-methylphenyl)urea (PubChem CID 53277091) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[1-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-phenylethyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[1-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-phenylethyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 53277091 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[1-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-phenylethyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NC(Cc2ccccc2)N2C(=O)C3C4C=CC(CC4)C3C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-16-7-13-20(14-8-16)27-26(32)28-21(15-17-5-3-2-4-6-17)29-24(30)22-18-9-10-19(12-11-18)23(22)25(29)31/h2-10,13-14,18-19,21-23H,11-12,15H2,1H3,(H2,27,28,32) |
| InChIKey | QRDGALHVNIMSQO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|