C32H27N3O4 — CID 98305552
1-[(1R)-1-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-2-phenylethyl]-3-(9-oxofluoren-2-yl)urea (PubChem CID 98305552) has the molecular formula C32H27N3O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 1-[(1R)-1-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-2-phenylethyl]-3-(9-oxofluoren-2-yl)urea.
| Compound Name | 1-[(1R)-1-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-2-phenylethyl]-3-(9-oxofluoren-2-yl)urea |
|---|---|
| PubChem CID | 98305552 |
| Molecular Formula | C32H27N3O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 1-[(1R)-1-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-2-phenylethyl]-3-(9-oxofluoren-2-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)c1ccccc1-2)N[C@@H](Cc1ccccc1)N1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C32H27N3O4/c36-29-24-9-5-4-8-22(24)23-15-14-21(17-25(23)29)33-32(39)34-26(16-18-6-2-1-3-7-18)35-30(37)27-19-10-11-20(13-12-19)28(27)31(35)38/h1-11,14-15,17,19-20,26-28H,12-13,16H2,(H2,33,34,39)/t19-,20-,26+,27-,28+/m0/s1 |
| InChIKey | DQKBKCCCVGASFF-AKHSPXGISA-N |
| XLogP | 4.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|