C26H23N3O4 — CID 98305346
1-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(9-oxofluoren-2-yl)urea (PubChem CID 98305346) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 1-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(9-oxofluoren-2-yl)urea.
| Compound Name | 1-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(9-oxofluoren-2-yl)urea |
|---|---|
| PubChem CID | 98305346 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[(1R)-1-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]ethyl]-3-(9-oxofluoren-2-yl)urea |
| SMILES | C[C@H](NC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1-2)N1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C26H23N3O4/c1-13(29-24(31)21-14-6-7-15(9-8-14)22(21)25(29)32)27-26(33)28-16-10-11-18-17-4-2-3-5-19(17)23(30)20(18)12-16/h2-7,10-15,21-22H,8-9H2,1H3,(H2,27,28,33)/t13-,14+,15+,21+,22+/m1/s1 |
| InChIKey | RUABZQXNPCHKQK-DMFDPQPSSA-N |
| XLogP | 3.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|