C24H18N2O4 — CID 19133815
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(9-oxofluoren-2-yl)acetamide (PubChem CID 19133815) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(9-oxofluoren-2-yl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(9-oxofluoren-2-yl)acetamide |
|---|---|
| PubChem CID | 19133815 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(9-oxofluoren-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C24H18N2O4/c27-19(11-26-23(29)20-12-5-6-13(9-12)21(20)24(26)30)25-14-7-8-16-15-3-1-2-4-17(15)22(28)18(16)10-14/h1-8,10,12-13,20-21H,9,11H2,(H,25,27) |
| InChIKey | XTVGTWUKLMRTSH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|