C25H19N3O5 — CID 56507837
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide (PubChem CID 56507837) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 56507837 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-[3-(1,3-dioxoisoindol-2-yl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H19N3O5/c29-19(12-27-24(32)20-13-8-9-14(10-13)21(20)25(27)33)26-15-4-3-5-16(11-15)28-22(30)17-6-1-2-7-18(17)23(28)31/h1-9,11,13-14,20-21H,10,12H2,(H,26,29) |
| InChIKey | MSWSZQVLUNZPCI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|