C23H18N2O4 — CID 7393941
N-dibenzofuran-3-yl-2-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide (PubChem CID 7393941) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-dibenzofuran-3-yl-2-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide.
| Compound Name | N-dibenzofuran-3-yl-2-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide |
|---|---|
| PubChem CID | 7393941 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-dibenzofuran-3-yl-2-[(1R,2S,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1)Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C23H18N2O4/c26-19(11-25-22(27)20-12-5-6-13(9-12)21(20)23(25)28)24-14-7-8-16-15-3-1-2-4-17(15)29-18(16)10-14/h1-8,10,12-13,20-21H,9,11H2,(H,24,26)/t12-,13+,20-,21+ |
| InChIKey | XZQWOWINEYSNAY-RUEWIVCDSA-N |
| XLogP | 3.33 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|