C16H12BrN3O3 — CID 19259003
1-(4-bromophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]urea (PubChem CID 19259003) has the molecular formula C16H12BrN3O3 and a molecular weight of 374.19 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 19259003 |
| Molecular Formula | C16H12BrN3O3 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 1-(4-bromophenyl)-3-[(1,3-dioxoisoindol-2-yl)methyl]urea |
| SMILES | O=C(NCN1C(=O)c2ccccc2C1=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrN3O3/c17-10-5-7-11(8-6-10)19-16(23)18-9-20-14(21)12-3-1-2-4-13(12)15(20)22/h1-8H,9H2,(H2,18,19,23) |
| InChIKey | PJRBMMXBMRZKQB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|