C14H13N5O3S — CID 19259014
1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 19259014) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 19259014 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCc1nnc(NC(=O)NCN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C14H13N5O3S/c1-2-10-17-18-14(23-10)16-13(22)15-7-19-11(20)8-5-3-4-6-9(8)12(19)21/h3-6H,2,7H2,1H3,(H2,15,16,18,22) |
| InChIKey | DXNLAENGNOECGJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|