C11H11ClN4OS — CID 22430369
1-(2-chlorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 22430369) has the molecular formula C11H11ClN4OS and a molecular weight of 282.76 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(2-chlorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 22430369 |
| Molecular Formula | C11H11ClN4OS |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-(2-chlorophenyl)-3-(5-ethyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCc1nnc(NC(=O)Nc2ccccc2Cl)s1 |
| InChI | InChI=1S/C11H11ClN4OS/c1-2-9-15-16-11(18-9)14-10(17)13-8-6-4-3-5-7(8)12/h3-6H,2H2,1H3,(H2,13,14,16,17) |
| InChIKey | JBDSVCRLMCAPCK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |